C21H21N3OS3 — CID 25339758
4-[[(5R)-2-(4-methoxyphenyl)-4,5-dihydro-1,3-thiazol-5-yl]methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine (PubChem CID 25339758) has the molecular formula C21H21N3OS3 and a molecular weight of 427.62 g/mol. Its IUPAC name is 4-[[(5R)-2-(4-methoxyphenyl)-4,5-dihydro-1,3-thiazol-5-yl]methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine.
| Compound Name | 4-[[(5R)-2-(4-methoxyphenyl)-4,5-dihydro-1,3-thiazol-5-yl]methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 25339758 |
| Molecular Formula | C21H21N3OS3 |
| Molecular Weight | 427.62 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 4-[[(5R)-2-(4-methoxyphenyl)-4,5-dihydro-1,3-thiazol-5-yl]methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
| SMILES | COc1ccc(C2=NC[C@H](CSc3ncnc4sc5c(c34)CCCC5)S2)cc1 |
| InChI | InChI=1S/C21H21N3OS3/c1-25-14-8-6-13(7-9-14)19-22-10-15(27-19)11-26-20-18-16-4-2-3-5-17(16)28-21(18)24-12-23-20/h6-9,12,15H,2-5,10-11H2,1H3/t15-/m1/s1 |
| InChIKey | MRQNTUHILCKISK-OAHLLOKOSA-N |
| XLogP | 5.23 |
| TPSA | 47.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.62 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |