About (5S)-2-(4-methoxyphenyl)-5-(pyridin-2-ylsulfanylmethyl)-4,5-dihydro-1,3-thiazole
(5S)-2-(4-methoxyphenyl)-5-(pyridin-2-ylsulfanylmethyl)-4,5-dihydro-1,3-thiazole (PubChem CID 2123339) has the molecular formula C16H16N2OS2
and a molecular weight of 316.45 g/mol. Its IUPAC name is (5S)-2-(4-methoxyphenyl)-5-(pyridin-2-ylsulfanylmethyl)-4,5-dihydro-1,3-thiazole.
Molecular Properties
| Compound Name | (5S)-2-(4-methoxyphenyl)-5-(pyridin-2-ylsulfanylmethyl)-4,5-dihydro-1,3-thiazole |
| PubChem CID | 2123339 |
| Molecular Formula | C16H16N2OS2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | (5S)-2-(4-methoxyphenyl)-5-(pyridin-2-ylsulfanylmethyl)-4,5-dihydro-1,3-thiazole |
| SMILES | COc1ccc(C2=NC[C@@H](CSc3ccccn3)S2)cc1 |
| InChI | InChI=1S/C16H16N2OS2/c1-19-13-7-5-12(6-8-13)16-18-10-14(21-16)11-20-15-4-2-3-9-17-15/h2-9,14H,10-11H2,1H3/t14-/m0/s1 |
| InChIKey | PJYUXQBTJUWYMR-AWEZNQCLSA-N |
| XLogP | 3.74 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5S)-2-(4-methoxyphenyl)-5-(pyridin-2-ylsulfanylmethyl)-4,5-dihydro-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-2-(4-methoxyphenyl)-5-(pyridin-2-ylsulfanylmethyl)-4,5-dihydro-1,3-thiazole?
The IUPAC name of (5S)-2-(4-methoxyphenyl)-5-(pyridin-2-ylsulfanylmethyl)-4,5-dihydro-1,3-thiazole (CID 2123339) is (5S)-2-(4-methoxyphenyl)-5-(pyridin-2-ylsulfanylmethyl)-4,5-dihydro-1,3-thiazole.
What is the SMILES notation for (5S)-2-(4-methoxyphenyl)-5-(pyridin-2-ylsulfanylmethyl)-4,5-dihydro-1,3-thiazole?
The canonical SMILES for (5S)-2-(4-methoxyphenyl)-5-(pyridin-2-ylsulfanylmethyl)-4,5-dihydro-1,3-thiazole is COc1ccc(C2=NC[C@@H](CSc3ccccn3)S2)cc1.
What is the InChIKey of (5S)-2-(4-methoxyphenyl)-5-(pyridin-2-ylsulfanylmethyl)-4,5-dihydro-1,3-thiazole?
The InChIKey is PJYUXQBTJUWYMR-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H16N2OS2/c1-19-13-7-5-12(6-8-13)16-18-10-14(21-16)11-20-15-4-2-3-9-17-15/h2-9,14H,10-11H2,1H3/t14-/m0/s1.
What are the key properties of (5S)-2-(4-methoxyphenyl)-5-(pyridin-2-ylsulfanylmethyl)-4,5-dihydro-1,3-thiazole?
(5S)-2-(4-methoxyphenyl)-5-(pyridin-2-ylsulfanylmethyl)-4,5-dihydro-1,3-thiazole has a molecular weight of 316.45 g/mol, XLogP of 3.74, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-2-(4-methoxyphenyl)-5-(pyridin-2-ylsulfanylmethyl)-4,5-dihydro-1,3-thiazole is sourced from PubChem (CID 2123339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).