C22H18Cl4N2O3S — CID 3114757
ethyl 4-phenyl-2-[[2,2,2-trichloro-1-[(4-chlorobenzoyl)amino]ethyl]amino]thiophene-3-carboxylate (PubChem CID 3114757) has the molecular formula C22H18Cl4N2O3S and a molecular weight of 532.28 g/mol. Its IUPAC name is ethyl 4-phenyl-2-[[2,2,2-trichloro-1-[(4-chlorobenzoyl)amino]ethyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-phenyl-2-[[2,2,2-trichloro-1-[(4-chlorobenzoyl)amino]ethyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3114757 |
| Molecular Formula | C22H18Cl4N2O3S |
| Molecular Weight | 532.28 g/mol |
| Exact Mass | 529.98 |
| IUPAC Name | ethyl 4-phenyl-2-[[2,2,2-trichloro-1-[(4-chlorobenzoyl)amino]ethyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(NC(=O)c1ccc(Cl)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C22H18Cl4N2O3S/c1-2-31-20(30)17-16(13-6-4-3-5-7-13)12-32-19(17)28-21(22(24,25)26)27-18(29)14-8-10-15(23)11-9-14/h3-12,21,28H,2H2,1H3,(H,27,29) |
| InChIKey | PUTCEPFFGZKGHB-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.28 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|