C23H20Cl3FN2O4S — CID 44615024
ethyl 4-phenyl-2-[[2,2,2-trichloro-1-[[2-(4-fluorophenoxy)acetyl]amino]ethyl]amino]thiophene-3-carboxylate (PubChem CID 44615024) has the molecular formula C23H20Cl3FN2O4S and a molecular weight of 545.85 g/mol. Its IUPAC name is ethyl 4-phenyl-2-[[2,2,2-trichloro-1-[[2-(4-fluorophenoxy)acetyl]amino]ethyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-phenyl-2-[[2,2,2-trichloro-1-[[2-(4-fluorophenoxy)acetyl]amino]ethyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 44615024 |
| Molecular Formula | C23H20Cl3FN2O4S |
| Molecular Weight | 545.85 g/mol |
| Exact Mass | 544.02 |
| IUPAC Name | ethyl 4-phenyl-2-[[2,2,2-trichloro-1-[[2-(4-fluorophenoxy)acetyl]amino]ethyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(NC(=O)COc1ccc(F)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C23H20Cl3FN2O4S/c1-2-32-21(31)19-17(14-6-4-3-5-7-14)13-34-20(19)29-22(23(24,25)26)28-18(30)12-33-16-10-8-15(27)9-11-16/h3-11,13,22,29H,2,12H2,1H3,(H,28,30) |
| InChIKey | OJFGQTAJSKQLMW-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.85 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|