C17H16Cl2N2O4S — CID 3116107
ethyl 2-[(2-chloroacetyl)amino]-5-[(3-chlorophenyl)carbamoyl]-4-methylthiophene-3-carboxylate (PubChem CID 3116107) has the molecular formula C17H16Cl2N2O4S and a molecular weight of 415.30 g/mol. Its IUPAC name is ethyl 2-[(2-chloroacetyl)amino]-5-[(3-chlorophenyl)carbamoyl]-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(2-chloroacetyl)amino]-5-[(3-chlorophenyl)carbamoyl]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 3116107 |
| Molecular Formula | C17H16Cl2N2O4S |
| Molecular Weight | 415.30 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | ethyl 2-[(2-chloroacetyl)amino]-5-[(3-chlorophenyl)carbamoyl]-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CCl)sc(C(=O)Nc2cccc(Cl)c2)c1C |
| InChI | InChI=1S/C17H16Cl2N2O4S/c1-3-25-17(24)13-9(2)14(26-16(13)21-12(22)8-18)15(23)20-11-6-4-5-10(19)7-11/h4-7H,3,8H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | ZOYABUZQHNCTPK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.30 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|