C47H37N6S2+ — CID 3116941
2-[2-[3-[5-(1,3-benzothiazol-2-yl)-3-ethyl-1-phenylbenzimidazol-3-ium-2-yl]prop-2-enylidene]-3-ethyl-1-phenylbenzimidazol-5-yl]-1,3-benzothiazole (PubChem CID 3116941) has the molecular formula C47H37N6S2+ and a molecular weight of 749.99 g/mol. Its IUPAC name is 2-[2-[3-[5-(1,3-benzothiazol-2-yl)-3-ethyl-1-phenylbenzimidazol-3-ium-2-yl]prop-2-enylidene]-3-ethyl-1-phenylbenzimidazol-5-yl]-1,3-benzothiazole.
| Compound Name | 2-[2-[3-[5-(1,3-benzothiazol-2-yl)-3-ethyl-1-phenylbenzimidazol-3-ium-2-yl]prop-2-enylidene]-3-ethyl-1-phenylbenzimidazol-5-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 3116941 |
| Molecular Formula | C47H37N6S2+ |
| Molecular Weight | 749.99 g/mol |
| Exact Mass | 749.25 |
| IUPAC Name | 2-[2-[3-[5-(1,3-benzothiazol-2-yl)-3-ethyl-1-phenylbenzimidazol-3-ium-2-yl]prop-2-enylidene]-3-ethyl-1-phenylbenzimidazol-5-yl]-1,3-benzothiazole |
| SMILES | CCN1C(=CC=Cc2n(-c3ccccc3)c3ccc(-c4nc5ccccc5s4)cc3[n+]2CC)N(c2ccccc2)c2ccc(-c3nc4ccccc4s3)cc21 |
| InChI | InChI=1S/C47H37N6S2/c1-3-50-40-30-32(46-48-36-20-11-13-22-42(36)54-46)26-28-38(40)52(34-16-7-5-8-17-34)44(50)24-15-25-45-51(4-2)41-31-33(47-49-37-21-12-14-23-43(37)55-47)27-29-39(41)53(45)35-18-9-6-10-19-35/h5-31H,3-4H2,1-2H3/q+1 |
| InChIKey | XSBFPUVILZTRSY-UHFFFAOYSA-N |
| XLogP | 12.02 |
| TPSA | 41.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.99 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|