C19H24N4O2S — CID 3117097
3-methyl-8-pentylsulfanyl-7-(2-phenylethyl)purine-2,6-dione (PubChem CID 3117097) has the molecular formula C19H24N4O2S and a molecular weight of 372.49 g/mol. Its IUPAC name is 3-methyl-8-pentylsulfanyl-7-(2-phenylethyl)purine-2,6-dione.
| Compound Name | 3-methyl-8-pentylsulfanyl-7-(2-phenylethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 3117097 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 3-methyl-8-pentylsulfanyl-7-(2-phenylethyl)purine-2,6-dione |
| SMILES | CCCCCSc1nc2c(c(=O)[nH]c(=O)n2C)n1CCc1ccccc1 |
| InChI | InChI=1S/C19H24N4O2S/c1-3-4-8-13-26-19-20-16-15(17(24)21-18(25)22(16)2)23(19)12-11-14-9-6-5-7-10-14/h5-7,9-10H,3-4,8,11-13H2,1-2H3,(H,21,24,25) |
| InChIKey | YKANBYPDWPUUJZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|