C9H7ClN2O2S — CID 3119524
5-(2-chloroanilino)-1,3-thiazolidine-2,4-dione (PubChem CID 3119524) has the molecular formula C9H7ClN2O2S and a molecular weight of 242.69 g/mol. Its IUPAC name is 5-(2-chloroanilino)-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-(2-chloroanilino)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 3119524 |
| Molecular Formula | C9H7ClN2O2S |
| Molecular Weight | 242.69 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 5-(2-chloroanilino)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Nc2ccccc2Cl)S1 |
| InChI | InChI=1S/C9H7ClN2O2S/c10-5-3-1-2-4-6(5)11-8-7(13)12-9(14)15-8/h1-4,8,11H,(H,12,13,14) |
| InChIKey | SOKRPKNTYSPBLQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.69 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|