C14H22N4O2 — CID 3122124
N'-cyclohexyl-N-(3-imidazol-1-ylpropyl)oxamide (PubChem CID 3122124) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is N'-cyclohexyl-N-(3-imidazol-1-ylpropyl)oxamide.
| Compound Name | N'-cyclohexyl-N-(3-imidazol-1-ylpropyl)oxamide |
|---|---|
| PubChem CID | 3122124 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | N'-cyclohexyl-N-(3-imidazol-1-ylpropyl)oxamide |
| SMILES | O=C(NCCCn1ccnc1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C14H22N4O2/c19-13(14(20)17-12-5-2-1-3-6-12)16-7-4-9-18-10-8-15-11-18/h8,10-12H,1-7,9H2,(H,16,19)(H,17,20) |
| InChIKey | FELIUKYGXNGBAU-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|