C22H30N2O3 — CID 31224187
1-[(1R,2R)-2-hydroxy-1-morpholin-4-ylspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl]-3-methylbut-2-en-1-one (PubChem CID 31224187) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is 1-[(1R,2R)-2-hydroxy-1-morpholin-4-ylspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl]-3-methylbut-2-en-1-one.
| Compound Name | 1-[(1R,2R)-2-hydroxy-1-morpholin-4-ylspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl]-3-methylbut-2-en-1-one |
|---|---|
| PubChem CID | 31224187 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 1-[(1R,2R)-2-hydroxy-1-morpholin-4-ylspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl]-3-methylbut-2-en-1-one |
| SMILES | CC(C)=CC(=O)N1CCC2(CC1)c1ccccc1[C@@H](N1CCOCC1)[C@@H]2O |
| InChI | InChI=1S/C22H30N2O3/c1-16(2)15-19(25)23-9-7-22(8-10-23)18-6-4-3-5-17(18)20(21(22)26)24-11-13-27-14-12-24/h3-6,15,20-21,26H,7-14H2,1-2H3/t20-,21+/m1/s1 |
| InChIKey | MMWGOGZIBOAXFN-RTWAWAEBSA-N |
| XLogP | 2.26 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|