C25H32F6N2O7 — CID 154889312
ethyl 2-[(1R,2R)-2-hydroxy-1-pyrrolidin-1-ylspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl]acetate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 154889312) has the molecular formula C25H32F6N2O7 and a molecular weight of 586.53 g/mol. Its IUPAC name is ethyl 2-[(1R,2R)-2-hydroxy-1-pyrrolidin-1-ylspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl]acetate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | ethyl 2-[(1R,2R)-2-hydroxy-1-pyrrolidin-1-ylspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl]acetate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 154889312 |
| Molecular Formula | C25H32F6N2O7 |
| Molecular Weight | 586.53 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | ethyl 2-[(1R,2R)-2-hydroxy-1-pyrrolidin-1-ylspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl]acetate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCOC(=O)CN1CCC2(CC1)c1ccccc1[C@@H](N1CCCC1)[C@@H]2O.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H30N2O3.2C2HF3O2/c1-2-26-18(24)15-22-13-9-21(10-14-22)17-8-4-3-7-16(17)19(20(21)25)23-11-5-6-12-23;2*3-2(4,5)1(6)7/h3-4,7-8,19-20,25H,2,5-6,9-15H2,1H3;2*(H,6,7)/t19-,20+;;/m1../s1 |
| InChIKey | MUQOWEZSCGXMLL-AAYDIPMQSA-N |
| XLogP | 3.36 |
| TPSA | 127.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |