About ethyl 2-spiro[3,4-dihydro-2H-isoquinoline-1,4'-piperidine]-1'-ylacetate
ethyl 2-spiro[3,4-dihydro-2H-isoquinoline-1,4'-piperidine]-1'-ylacetate (PubChem CID 121350888) has the molecular formula C17H24N2O2
and a molecular weight of 288.39 g/mol. Its IUPAC name is ethyl 2-spiro[3,4-dihydro-2H-isoquinoline-1,4'-piperidine]-1'-ylacetate.
Molecular Properties
| Compound Name | ethyl 2-spiro[3,4-dihydro-2H-isoquinoline-1,4'-piperidine]-1'-ylacetate |
| PubChem CID | 121350888 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | ethyl 2-spiro[3,4-dihydro-2H-isoquinoline-1,4'-piperidine]-1'-ylacetate |
| SMILES | CCOC(=O)CN1CCC2(CC1)NCCc1ccccc12 |
| InChI | InChI=1S/C17H24N2O2/c1-2-21-16(20)13-19-11-8-17(9-12-19)15-6-4-3-5-14(15)7-10-18-17/h3-6,18H,2,7-13H2,1H3 |
| InChIKey | JHLINMNTHOPGFA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-spiro[3,4-dihydro-2H-isoquinoline-1,4'-piperidine]-1'-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-spiro[3,4-dihydro-2H-isoquinoline-1,4'-piperidine]-1'-ylacetate?
The IUPAC name of ethyl 2-spiro[3,4-dihydro-2H-isoquinoline-1,4'-piperidine]-1'-ylacetate (CID 121350888) is ethyl 2-spiro[3,4-dihydro-2H-isoquinoline-1,4'-piperidine]-1'-ylacetate.
What is the SMILES notation for ethyl 2-spiro[3,4-dihydro-2H-isoquinoline-1,4'-piperidine]-1'-ylacetate?
The canonical SMILES for ethyl 2-spiro[3,4-dihydro-2H-isoquinoline-1,4'-piperidine]-1'-ylacetate is CCOC(=O)CN1CCC2(CC1)NCCc1ccccc12.
What is the InChIKey of ethyl 2-spiro[3,4-dihydro-2H-isoquinoline-1,4'-piperidine]-1'-ylacetate?
The InChIKey is JHLINMNTHOPGFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O2/c1-2-21-16(20)13-19-11-8-17(9-12-19)15-6-4-3-5-14(15)7-10-18-17/h3-6,18H,2,7-13H2,1H3.
What are the key properties of ethyl 2-spiro[3,4-dihydro-2H-isoquinoline-1,4'-piperidine]-1'-ylacetate?
ethyl 2-spiro[3,4-dihydro-2H-isoquinoline-1,4'-piperidine]-1'-ylacetate has a molecular weight of 288.39 g/mol, XLogP of 1.69, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-spiro[3,4-dihydro-2H-isoquinoline-1,4'-piperidine]-1'-ylacetate is sourced from PubChem (CID 121350888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).