C13H8N4O5 — CID 3123222
8,10-dinitro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one (PubChem CID 3123222) has the molecular formula C13H8N4O5 and a molecular weight of 300.23 g/mol. Its IUPAC name is 8,10-dinitro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 8,10-dinitro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 3123222 |
| Molecular Formula | C13H8N4O5 |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 8,10-dinitro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
| SMILES | O=C1Nc2ccccc2Nc2c1cc([N+](=O)[O-])cc2[N+](=O)[O-] |
| InChI | InChI=1S/C13H8N4O5/c18-13-8-5-7(16(19)20)6-11(17(21)22)12(8)14-9-3-1-2-4-10(9)15-13/h1-6,14H,(H,15,18) |
| InChIKey | HQANKFBCTNTADV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|