C19H15N3O6S2 — CID 3123605
ethyl 7-methyl-2-[(5-nitrofuran-2-yl)methylidene]-3-oxo-5-thiophen-2-yl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 3123605) has the molecular formula C19H15N3O6S2 and a molecular weight of 445.48 g/mol. Its IUPAC name is ethyl 7-methyl-2-[(5-nitrofuran-2-yl)methylidene]-3-oxo-5-thiophen-2-yl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 7-methyl-2-[(5-nitrofuran-2-yl)methylidene]-3-oxo-5-thiophen-2-yl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 3123605 |
| Molecular Formula | C19H15N3O6S2 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | ethyl 7-methyl-2-[(5-nitrofuran-2-yl)methylidene]-3-oxo-5-thiophen-2-yl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2sc(=Cc3ccc([N+](=O)[O-])o3)c(=O)n2C1c1cccs1 |
| InChI | InChI=1S/C19H15N3O6S2/c1-3-27-18(24)15-10(2)20-19-21(16(15)12-5-4-8-29-12)17(23)13(30-19)9-11-6-7-14(28-11)22(25)26/h4-9,16H,3H2,1-2H3 |
| InChIKey | PYFJSYVZEOICOH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 116.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|