C20H20ClNO3 — CID 31236171
N-benzyl-5-chloro-N-(2-methoxyethyl)-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 31236171) has the molecular formula C20H20ClNO3 and a molecular weight of 357.84 g/mol. Its IUPAC name is N-benzyl-5-chloro-N-(2-methoxyethyl)-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-benzyl-5-chloro-N-(2-methoxyethyl)-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 31236171 |
| Molecular Formula | C20H20ClNO3 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | N-benzyl-5-chloro-N-(2-methoxyethyl)-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | COCCN(Cc1ccccc1)C(=O)c1oc2ccc(Cl)cc2c1C |
| InChI | InChI=1S/C20H20ClNO3/c1-14-17-12-16(21)8-9-18(17)25-19(14)20(23)22(10-11-24-2)13-15-6-4-3-5-7-15/h3-9,12H,10-11,13H2,1-2H3 |
| InChIKey | LBIPKJMVCDDVQJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |