C25H29F3N2O4 — CID 3123694
2-(3,4-dimethoxyphenyl)-1-[5-hydroxy-5-(4-pentylphenyl)-3-(trifluoromethyl)-4H-pyrazol-1-yl]ethanone (PubChem CID 3123694) has the molecular formula C25H29F3N2O4 and a molecular weight of 478.51 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1-[5-hydroxy-5-(4-pentylphenyl)-3-(trifluoromethyl)-4H-pyrazol-1-yl]ethanone.
| Compound Name | 2-(3,4-dimethoxyphenyl)-1-[5-hydroxy-5-(4-pentylphenyl)-3-(trifluoromethyl)-4H-pyrazol-1-yl]ethanone |
|---|---|
| PubChem CID | 3123694 |
| Molecular Formula | C25H29F3N2O4 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1-[5-hydroxy-5-(4-pentylphenyl)-3-(trifluoromethyl)-4H-pyrazol-1-yl]ethanone |
| SMILES | CCCCCc1ccc(C2(O)CC(C(F)(F)F)=NN2C(=O)Cc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C25H29F3N2O4/c1-4-5-6-7-17-8-11-19(12-9-17)24(32)16-22(25(26,27)28)29-30(24)23(31)15-18-10-13-20(33-2)21(14-18)34-3/h8-14,32H,4-7,15-16H2,1-3H3 |
| InChIKey | ZGKQCFJKJIEJJJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|