C31H27ClN4O3 — CID 3125649
1-(adamantane-1-carbonyl)-2-(4-chloro-3-nitrophenyl)-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,3-dicarbonitrile (PubChem CID 3125649) has the molecular formula C31H27ClN4O3 and a molecular weight of 539.04 g/mol. Its IUPAC name is 1-(adamantane-1-carbonyl)-2-(4-chloro-3-nitrophenyl)-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,3-dicarbonitrile.
| Compound Name | 1-(adamantane-1-carbonyl)-2-(4-chloro-3-nitrophenyl)-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,3-dicarbonitrile |
|---|---|
| PubChem CID | 3125649 |
| Molecular Formula | C31H27ClN4O3 |
| Molecular Weight | 539.04 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | 1-(adamantane-1-carbonyl)-2-(4-chloro-3-nitrophenyl)-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,3-dicarbonitrile |
| SMILES | N#CC1(C#N)C(c2ccc(Cl)c([N+](=O)[O-])c2)C(C(=O)C23CC4CC(CC(C4)C2)C3)N2c3ccccc3C=CC21 |
| InChI | InChI=1S/C31H27ClN4O3/c32-23-7-5-22(12-25(23)36(38)39)27-28(29(37)30-13-18-9-19(14-30)11-20(10-18)15-30)35-24-4-2-1-3-21(24)6-8-26(35)31(27,16-33)17-34/h1-8,12,18-20,26-28H,9-11,13-15H2 |
| InChIKey | ZWZFGQHGSRWQTE-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 111.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.04 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|