C29H27N3OS — CID 98893699
(1R,2S,3aR)-1-(adamantane-1-carbonyl)-2-thiophen-2-yl-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,3-dicarbonitrile (PubChem CID 98893699) has the molecular formula C29H27N3OS and a molecular weight of 465.62 g/mol. Its IUPAC name is (1R,2S,3aR)-1-(adamantane-1-carbonyl)-2-thiophen-2-yl-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,3-dicarbonitrile.
| Compound Name | (1R,2S,3aR)-1-(adamantane-1-carbonyl)-2-thiophen-2-yl-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,3-dicarbonitrile |
|---|---|
| PubChem CID | 98893699 |
| Molecular Formula | C29H27N3OS |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | (1R,2S,3aR)-1-(adamantane-1-carbonyl)-2-thiophen-2-yl-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,3-dicarbonitrile |
| SMILES | N#CC1(C#N)[C@H](c2cccs2)[C@H](C(=O)C23CC4CC(CC(C4)C2)C3)N2c3ccccc3C=C[C@@H]21 |
| InChI | InChI=1S/C29H27N3OS/c30-16-29(17-31)24-8-7-21-4-1-2-5-22(21)32(24)26(25(29)23-6-3-9-34-23)27(33)28-13-18-10-19(14-28)12-20(11-18)15-28/h1-9,18-20,24-26H,10-15H2/t18?,19?,20?,24-,25-,26-,28?/m1/s1 |
| InChIKey | UKRNUAJXZWEDEO-MTUVZHAASA-N |
| XLogP | 5.93 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |