C23H21N3OS — CID 6579547
(1R,2R,3aS)-1-(2,2-dimethylpropanoyl)-2-thiophen-2-yl-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,3-dicarbonitrile (PubChem CID 6579547) has the molecular formula C23H21N3OS and a molecular weight of 387.51 g/mol. Its IUPAC name is (1R,2R,3aS)-1-(2,2-dimethylpropanoyl)-2-thiophen-2-yl-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,3-dicarbonitrile.
| Compound Name | (1R,2R,3aS)-1-(2,2-dimethylpropanoyl)-2-thiophen-2-yl-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,3-dicarbonitrile |
|---|---|
| PubChem CID | 6579547 |
| Molecular Formula | C23H21N3OS |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | (1R,2R,3aS)-1-(2,2-dimethylpropanoyl)-2-thiophen-2-yl-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,3-dicarbonitrile |
| SMILES | CC(C)(C)C(=O)[C@H]1[C@H](c2cccs2)C(C#N)(C#N)[C@@H]2C=Cc3ccccc3N21 |
| InChI | InChI=1S/C23H21N3OS/c1-22(2,3)21(27)20-19(17-9-6-12-28-17)23(13-24,14-25)18-11-10-15-7-4-5-8-16(15)26(18)20/h4-12,18-20H,1-3H3/t18-,19-,20+/m0/s1 |
| InChIKey | OERFJXTZGQYROY-SLFFLAALSA-N |
| XLogP | 4.76 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |