C20H20N2OS — CID 5088699
2-(adamantane-1-carbonyl)-3-thiophen-2-ylcyclopropane-1,1-dicarbonitrile (PubChem CID 5088699) has the molecular formula C20H20N2OS and a molecular weight of 336.46 g/mol. Its IUPAC name is 2-(adamantane-1-carbonyl)-3-thiophen-2-ylcyclopropane-1,1-dicarbonitrile.
| Compound Name | 2-(adamantane-1-carbonyl)-3-thiophen-2-ylcyclopropane-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 5088699 |
| Molecular Formula | C20H20N2OS |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2-(adamantane-1-carbonyl)-3-thiophen-2-ylcyclopropane-1,1-dicarbonitrile |
| SMILES | N#CC1(C#N)C(C(=O)C23CC4CC(CC(C4)C2)C3)C1c1cccs1 |
| InChI | InChI=1S/C20H20N2OS/c21-10-20(11-22)16(15-2-1-3-24-15)17(20)18(23)19-7-12-4-13(8-19)6-14(5-12)9-19/h1-3,12-14,16-17H,4-9H2 |
| InChIKey | FCCUBBRYZFXJAS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_cyano_B(3)', 'substructure': 'N/A'} |
|---|