C24H26N2O — CID 7311010
cis-(2S,3S)-2-(adamantane-1-carbonyl)-3-(4-ethylphenyl)cyclopropane-1,1-dicarbonitrile (PubChem CID 7311010) has the molecular formula C24H26N2O and a molecular weight of 358.49 g/mol. Its IUPAC name is cis-(2S,3S)-2-(adamantane-1-carbonyl)-3-(4-ethylphenyl)cyclopropane-1,1-dicarbonitrile.
| Compound Name | cis-(2S,3S)-2-(adamantane-1-carbonyl)-3-(4-ethylphenyl)cyclopropane-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 7311010 |
| Molecular Formula | C24H26N2O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | cis-(2S,3S)-2-(adamantane-1-carbonyl)-3-(4-ethylphenyl)cyclopropane-1,1-dicarbonitrile |
| SMILES | CCc1ccc([C@@H]2[C@H](C(=O)C34CC5CC(CC(C5)C3)C4)C2(C#N)C#N)cc1 |
| InChI | InChI=1S/C24H26N2O/c1-2-15-3-5-19(6-4-15)20-21(24(20,13-25)14-26)22(27)23-10-16-7-17(11-23)9-18(8-16)12-23/h3-6,16-18,20-21H,2,7-12H2,1H3/t16?,17?,18?,20-,21-,23?/m1/s1 |
| InChIKey | XHRHCUJHPPAIHA-MAKNYPIPSA-N |
| XLogP | 4.78 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyano_cyano_B(3)', 'substructure': 'N/A'} |
|---|