C22H28O3 — CID 7873769
[(2R)-1-(4-ethylphenyl)-1-oxopropan-2-yl] adamantane-1-carboxylate (PubChem CID 7873769) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is [(2R)-1-(4-ethylphenyl)-1-oxopropan-2-yl] adamantane-1-carboxylate.
| Compound Name | [(2R)-1-(4-ethylphenyl)-1-oxopropan-2-yl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 7873769 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | [(2R)-1-(4-ethylphenyl)-1-oxopropan-2-yl] adamantane-1-carboxylate |
| SMILES | CCc1ccc(C(=O)[C@@H](C)OC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C22H28O3/c1-3-15-4-6-19(7-5-15)20(23)14(2)25-21(24)22-11-16-8-17(12-22)10-18(9-16)13-22/h4-7,14,16-18H,3,8-13H2,1-2H3/t14-,16?,17?,18?,22?/m1/s1 |
| InChIKey | DRVZVPSCJYPFRE-YMXMSLLWSA-N |
| XLogP | 4.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |