C17H20N2O3 — CID 3126353
2-amino-4-(1-hydroxypenta-1,3-dienyl)-7,7-dimethyl-5-oxo-6,8-dihydro-4H-chromene-3-carbonitrile (PubChem CID 3126353) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-amino-4-(1-hydroxypenta-1,3-dienyl)-7,7-dimethyl-5-oxo-6,8-dihydro-4H-chromene-3-carbonitrile.
| Compound Name | 2-amino-4-(1-hydroxypenta-1,3-dienyl)-7,7-dimethyl-5-oxo-6,8-dihydro-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 3126353 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 2-amino-4-(1-hydroxypenta-1,3-dienyl)-7,7-dimethyl-5-oxo-6,8-dihydro-4H-chromene-3-carbonitrile |
| SMILES | CC=CC=C(O)C1C(C#N)=C(N)OC2=C1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C17H20N2O3/c1-4-5-6-11(20)14-10(9-18)16(19)22-13-8-17(2,3)7-12(21)15(13)14/h4-6,14,20H,7-8,19H2,1-3H3 |
| InChIKey | HBKJIWCWIGILQZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|