C21H22FN3O3S — CID 3126858
[2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl] N-(4-fluorophenyl)-N'-methylcarbamimidothioate (PubChem CID 3126858) has the molecular formula C21H22FN3O3S and a molecular weight of 415.49 g/mol. Its IUPAC name is [2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl] N-(4-fluorophenyl)-N'-methylcarbamimidothioate.
| Compound Name | [2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl] N-(4-fluorophenyl)-N'-methylcarbamimidothioate |
|---|---|
| PubChem CID | 3126858 |
| Molecular Formula | C21H22FN3O3S |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | [2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl] N-(4-fluorophenyl)-N'-methylcarbamimidothioate |
| SMILES | CCCOc1ccc(N2C(=O)CC(S/C(=N/C)Nc3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C21H22FN3O3S/c1-3-12-28-17-10-8-16(9-11-17)25-19(26)13-18(20(25)27)29-21(23-2)24-15-6-4-14(22)5-7-15/h4-11,18H,3,12-13H2,1-2H3,(H,23,24) |
| InChIKey | SVOSHJSTUCNJRQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|