C20H23N3O6S — CID 3127960
ethyl 5-ethyl-2-[(3-morpholin-4-yl-4-nitrobenzoyl)amino]thiophene-3-carboxylate (PubChem CID 3127960) has the molecular formula C20H23N3O6S and a molecular weight of 433.49 g/mol. Its IUPAC name is ethyl 5-ethyl-2-[(3-morpholin-4-yl-4-nitrobenzoyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-ethyl-2-[(3-morpholin-4-yl-4-nitrobenzoyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3127960 |
| Molecular Formula | C20H23N3O6S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | ethyl 5-ethyl-2-[(3-morpholin-4-yl-4-nitrobenzoyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CC)sc1NC(=O)c1ccc([N+](=O)[O-])c(N2CCOCC2)c1 |
| InChI | InChI=1S/C20H23N3O6S/c1-3-14-12-15(20(25)29-4-2)19(30-14)21-18(24)13-5-6-16(23(26)27)17(11-13)22-7-9-28-10-8-22/h5-6,11-12H,3-4,7-10H2,1-2H3,(H,21,24) |
| InChIKey | FPQLFBLZLQHHOM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|