C21H14F3N3O2 — CID 31279912
3-(5-methylfuran-2-yl)-1-phenyl-N-(2,3,4-trifluorophenyl)pyrazole-4-carboxamide (PubChem CID 31279912) has the molecular formula C21H14F3N3O2 and a molecular weight of 397.36 g/mol. Its IUPAC name is 3-(5-methylfuran-2-yl)-1-phenyl-N-(2,3,4-trifluorophenyl)pyrazole-4-carboxamide.
| Compound Name | 3-(5-methylfuran-2-yl)-1-phenyl-N-(2,3,4-trifluorophenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 31279912 |
| Molecular Formula | C21H14F3N3O2 |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 3-(5-methylfuran-2-yl)-1-phenyl-N-(2,3,4-trifluorophenyl)pyrazole-4-carboxamide |
| SMILES | Cc1ccc(-c2nn(-c3ccccc3)cc2C(=O)Nc2ccc(F)c(F)c2F)o1 |
| InChI | InChI=1S/C21H14F3N3O2/c1-12-7-10-17(29-12)20-14(11-27(26-20)13-5-3-2-4-6-13)21(28)25-16-9-8-15(22)18(23)19(16)24/h2-11H,1H3,(H,25,28) |
| InChIKey | FCFIWJHKMIRODP-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|