C23H18ClN3O4 — CID 55338476
methyl 4-chloro-3-[[3-(5-methylfuran-2-yl)-1-phenylpyrazole-4-carbonyl]amino]benzoate (PubChem CID 55338476) has the molecular formula C23H18ClN3O4 and a molecular weight of 435.87 g/mol. Its IUPAC name is methyl 4-chloro-3-[[3-(5-methylfuran-2-yl)-1-phenylpyrazole-4-carbonyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[3-(5-methylfuran-2-yl)-1-phenylpyrazole-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 55338476 |
| Molecular Formula | C23H18ClN3O4 |
| Molecular Weight | 435.87 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | methyl 4-chloro-3-[[3-(5-methylfuran-2-yl)-1-phenylpyrazole-4-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)c2cn(-c3ccccc3)nc2-c2ccc(C)o2)c1 |
| InChI | InChI=1S/C23H18ClN3O4/c1-14-8-11-20(31-14)21-17(13-27(26-21)16-6-4-3-5-7-16)22(28)25-19-12-15(23(29)30-2)9-10-18(19)24/h3-13H,1-2H3,(H,25,28) |
| InChIKey | NMNCAXXKUMKJPX-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.87 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |