C23H19ClN4O4 — CID 51925163
[(2R)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 3-(5-methylfuran-2-yl)-1-phenylpyrazole-4-carboxylate (PubChem CID 51925163) has the molecular formula C23H19ClN4O4 and a molecular weight of 450.88 g/mol. Its IUPAC name is [(2R)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 3-(5-methylfuran-2-yl)-1-phenylpyrazole-4-carboxylate.
| Compound Name | [(2R)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 3-(5-methylfuran-2-yl)-1-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 51925163 |
| Molecular Formula | C23H19ClN4O4 |
| Molecular Weight | 450.88 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | [(2R)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 3-(5-methylfuran-2-yl)-1-phenylpyrazole-4-carboxylate |
| SMILES | Cc1ccc(-c2nn(-c3ccccc3)cc2C(=O)O[C@H](C)C(=O)Nc2cccnc2Cl)o1 |
| InChI | InChI=1S/C23H19ClN4O4/c1-14-10-11-19(31-14)20-17(13-28(27-20)16-7-4-3-5-8-16)23(30)32-15(2)22(29)26-18-9-6-12-25-21(18)24/h3-13,15H,1-2H3,(H,26,29)/t15-/m1/s1 |
| InChIKey | XGLLILQGDOSUQF-OAHLLOKOSA-N |
| XLogP | 4.67 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.88 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|