C19H26FN3O2 — CID 31281288
(5R,6S)-3-[[ethyl-[(3-fluorophenyl)methyl]amino]methyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 31281288) has the molecular formula C19H26FN3O2 and a molecular weight of 347.43 g/mol. Its IUPAC name is (5R,6S)-3-[[ethyl-[(3-fluorophenyl)methyl]amino]methyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5R,6S)-3-[[ethyl-[(3-fluorophenyl)methyl]amino]methyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 31281288 |
| Molecular Formula | C19H26FN3O2 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | (5R,6S)-3-[[ethyl-[(3-fluorophenyl)methyl]amino]methyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CCN(Cc1cccc(F)c1)CN1C(=O)N[C@@]2(CCCC[C@@H]2C)C1=O |
| InChI | InChI=1S/C19H26FN3O2/c1-3-22(12-15-8-6-9-16(20)11-15)13-23-17(24)19(21-18(23)25)10-5-4-7-14(19)2/h6,8-9,11,14H,3-5,7,10,12-13H2,1-2H3,(H,21,25)/t14-,19+/m0/s1 |
| InChIKey | BQCKKSSFRGVOCH-IFXJQAMLSA-N |
| XLogP | 3.11 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|