C19H15F3N6O3 — CID 31315011
2-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]-N-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]benzamide (PubChem CID 31315011) has the molecular formula C19H15F3N6O3 and a molecular weight of 432.36 g/mol. Its IUPAC name is 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]-N-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]benzamide.
| Compound Name | 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]-N-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 31315011 |
| Molecular Formula | C19H15F3N6O3 |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]-N-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]benzamide |
| SMILES | Cc1nc(COc2ccccc2C(=O)NCc2nnc3ccc(C(F)(F)F)cn23)no1 |
| InChI | InChI=1S/C19H15F3N6O3/c1-11-24-15(27-31-11)10-30-14-5-3-2-4-13(14)18(29)23-8-17-26-25-16-7-6-12(9-28(16)17)19(20,21)22/h2-7,9H,8,10H2,1H3,(H,23,29) |
| InChIKey | JMSKJTHBFPMFNF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |