C16H12F3N5O3 — CID 16960785
2-methyl-3-nitro-N-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]benzamide (PubChem CID 16960785) has the molecular formula C16H12F3N5O3 and a molecular weight of 379.30 g/mol. Its IUPAC name is 2-methyl-3-nitro-N-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]benzamide.
| Compound Name | 2-methyl-3-nitro-N-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 16960785 |
| Molecular Formula | C16H12F3N5O3 |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 2-methyl-3-nitro-N-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]benzamide |
| SMILES | Cc1c(C(=O)NCc2nnc3ccc(C(F)(F)F)cn23)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12F3N5O3/c1-9-11(3-2-4-12(9)24(26)27)15(25)20-7-14-22-21-13-6-5-10(8-23(13)14)16(17,18)19/h2-6,8H,7H2,1H3,(H,20,25) |
| InChIKey | GNDCJYQIMMCZRW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|