C16H12F3N5O4 — CID 51260119
2-(2-nitrophenoxy)-N-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]acetamide (PubChem CID 51260119) has the molecular formula C16H12F3N5O4 and a molecular weight of 395.30 g/mol. Its IUPAC name is 2-(2-nitrophenoxy)-N-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]acetamide.
| Compound Name | 2-(2-nitrophenoxy)-N-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 51260119 |
| Molecular Formula | C16H12F3N5O4 |
| Molecular Weight | 395.30 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 2-(2-nitrophenoxy)-N-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]acetamide |
| SMILES | O=C(COc1ccccc1[N+](=O)[O-])NCc1nnc2ccc(C(F)(F)F)cn12 |
| InChI | InChI=1S/C16H12F3N5O4/c17-16(18,19)10-5-6-13-21-22-14(23(13)8-10)7-20-15(25)9-28-12-4-2-1-3-11(12)24(26)27/h1-6,8H,7,9H2,(H,20,25) |
| InChIKey | WCQSQJRDFBWLKS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|