C18H19NO4 — CID 3131753
N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-4-ethoxybenzamide (PubChem CID 3131753) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-4-ethoxybenzamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-4-ethoxybenzamide |
|---|---|
| PubChem CID | 3131753 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NCC2COc3ccccc3O2)cc1 |
| InChI | InChI=1S/C18H19NO4/c1-2-21-14-9-7-13(8-10-14)18(20)19-11-15-12-22-16-5-3-4-6-17(16)23-15/h3-10,15H,2,11-12H2,1H3,(H,19,20) |
| InChIKey | LLKMPSBGDYSRCI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |