C20H23NO5 — CID 8872749
N-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-3,4-diethoxybenzamide (PubChem CID 8872749) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-3,4-diethoxybenzamide.
| Compound Name | N-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 8872749 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | N-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NC[C@H]2COc3ccccc3O2)cc1OCC |
| InChI | InChI=1S/C20H23NO5/c1-3-23-17-10-9-14(11-19(17)24-4-2)20(22)21-12-15-13-25-16-7-5-6-8-18(16)26-15/h5-11,15H,3-4,12-13H2,1-2H3,(H,21,22)/t15-/m0/s1 |
| InChIKey | FMDFKSNOZHTVKK-HNNXBMFYSA-N |
| XLogP | 3.05 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |