C24H28N4O3S — CID 31321073
3-(2-methylphenyl)-5-[[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazin-1-yl]methyl]-1,2,4-oxadiazole (PubChem CID 31321073) has the molecular formula C24H28N4O3S and a molecular weight of 452.58 g/mol. Its IUPAC name is 3-(2-methylphenyl)-5-[[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazin-1-yl]methyl]-1,2,4-oxadiazole.
| Compound Name | 3-(2-methylphenyl)-5-[[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazin-1-yl]methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 31321073 |
| Molecular Formula | C24H28N4O3S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 3-(2-methylphenyl)-5-[[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazin-1-yl]methyl]-1,2,4-oxadiazole |
| SMILES | Cc1ccccc1-c1noc(CN2CCN(S(=O)(=O)c3ccc4c(c3)CCCC4)CC2)n1 |
| InChI | InChI=1S/C24H28N4O3S/c1-18-6-2-5-9-22(18)24-25-23(31-26-24)17-27-12-14-28(15-13-27)32(29,30)21-11-10-19-7-3-4-8-20(19)16-21/h2,5-6,9-11,16H,3-4,7-8,12-15,17H2,1H3 |
| InChIKey | HVQGWSGLSBNPAU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |