C23H28N4O2 — CID 46443595
4,5-dimethyl-2-[[4-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]methyl]phenol (PubChem CID 46443595) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 4,5-dimethyl-2-[[4-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]methyl]phenol.
| Compound Name | 4,5-dimethyl-2-[[4-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 46443595 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 4,5-dimethyl-2-[[4-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]methyl]phenol |
| SMILES | Cc1cc(O)c(CN2CCN(Cc3nc(-c4ccccc4C)no3)CC2)cc1C |
| InChI | InChI=1S/C23H28N4O2/c1-16-6-4-5-7-20(16)23-24-22(29-25-23)15-27-10-8-26(9-11-27)14-19-12-17(2)18(3)13-21(19)28/h4-7,12-13,28H,8-11,14-15H2,1-3H3 |
| InChIKey | GADZJWCHCCLLPS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|