C21H21IN4O2 — CID 39586517
(3-iodophenyl)-[4-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]methanone (PubChem CID 39586517) has the molecular formula C21H21IN4O2 and a molecular weight of 488.33 g/mol. Its IUPAC name is (3-iodophenyl)-[4-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]methanone.
| Compound Name | (3-iodophenyl)-[4-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 39586517 |
| Molecular Formula | C21H21IN4O2 |
| Molecular Weight | 488.33 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | (3-iodophenyl)-[4-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]methanone |
| SMILES | Cc1ccccc1-c1noc(CN2CCN(C(=O)c3cccc(I)c3)CC2)n1 |
| InChI | InChI=1S/C21H21IN4O2/c1-15-5-2-3-8-18(15)20-23-19(28-24-20)14-25-9-11-26(12-10-25)21(27)16-6-4-7-17(22)13-16/h2-8,13H,9-12,14H2,1H3 |
| InChIKey | CEKODMUCRYHAGN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|