C25H29BrN4O2 — CID 55853353
5-(4-bromophenyl)-1-[4-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]pentan-1-one (PubChem CID 55853353) has the molecular formula C25H29BrN4O2 and a molecular weight of 497.44 g/mol. Its IUPAC name is 5-(4-bromophenyl)-1-[4-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]pentan-1-one.
| Compound Name | 5-(4-bromophenyl)-1-[4-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 55853353 |
| Molecular Formula | C25H29BrN4O2 |
| Molecular Weight | 497.44 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 5-(4-bromophenyl)-1-[4-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]pentan-1-one |
| SMILES | Cc1ccccc1-c1noc(CN2CCN(C(=O)CCCCc3ccc(Br)cc3)CC2)n1 |
| InChI | InChI=1S/C25H29BrN4O2/c1-19-6-2-4-8-22(19)25-27-23(32-28-25)18-29-14-16-30(17-15-29)24(31)9-5-3-7-20-10-12-21(26)13-11-20/h2,4,6,8,10-13H,3,5,7,9,14-18H2,1H3 |
| InChIKey | BMPYFYMJUJUUDU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|