C21H28BrN3O2 — CID 60508436
5-(4-bromophenyl)-1-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]piperazin-1-yl]pentan-1-one (PubChem CID 60508436) has the molecular formula C21H28BrN3O2 and a molecular weight of 434.38 g/mol. Its IUPAC name is 5-(4-bromophenyl)-1-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]piperazin-1-yl]pentan-1-one.
| Compound Name | 5-(4-bromophenyl)-1-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 60508436 |
| Molecular Formula | C21H28BrN3O2 |
| Molecular Weight | 434.38 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 5-(4-bromophenyl)-1-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]piperazin-1-yl]pentan-1-one |
| SMILES | Cc1noc(C)c1CN1CCN(C(=O)CCCCc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C21H28BrN3O2/c1-16-20(17(2)27-23-16)15-24-11-13-25(14-12-24)21(26)6-4-3-5-18-7-9-19(22)10-8-18/h7-10H,3-6,11-15H2,1-2H3 |
| InChIKey | XPILOXDXKHKZHA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|