C21H21ClN4O4 — CID 31326245
N-[[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]methyl]-3-hydroxy-N-methyl-4-nitrobenzamide (PubChem CID 31326245) has the molecular formula C21H21ClN4O4 and a molecular weight of 428.88 g/mol. Its IUPAC name is N-[[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]methyl]-3-hydroxy-N-methyl-4-nitrobenzamide.
| Compound Name | N-[[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]methyl]-3-hydroxy-N-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 31326245 |
| Molecular Formula | C21H21ClN4O4 |
| Molecular Weight | 428.88 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | N-[[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]methyl]-3-hydroxy-N-methyl-4-nitrobenzamide |
| SMILES | Cc1nn(Cc2ccccc2Cl)c(C)c1CN(C)C(=O)c1ccc([N+](=O)[O-])c(O)c1 |
| InChI | InChI=1S/C21H21ClN4O4/c1-13-17(14(2)25(23-13)11-16-6-4-5-7-18(16)22)12-24(3)21(28)15-8-9-19(26(29)30)20(27)10-15/h4-10,27H,11-12H2,1-3H3 |
| InChIKey | MKHWTYWQECPCFA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.88 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|