C23H27ClN4O — CID 35591804
1-[(2-chlorophenyl)methyl]-N-[[4-(dimethylamino)phenyl]methyl]-N,3,5-trimethylpyrazole-4-carboxamide (PubChem CID 35591804) has the molecular formula C23H27ClN4O and a molecular weight of 410.95 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-N-[[4-(dimethylamino)phenyl]methyl]-N,3,5-trimethylpyrazole-4-carboxamide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-N-[[4-(dimethylamino)phenyl]methyl]-N,3,5-trimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 35591804 |
| Molecular Formula | C23H27ClN4O |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-N-[[4-(dimethylamino)phenyl]methyl]-N,3,5-trimethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(Cc2ccccc2Cl)c(C)c1C(=O)N(C)Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C23H27ClN4O/c1-16-22(17(2)28(25-16)15-19-8-6-7-9-21(19)24)23(29)27(5)14-18-10-12-20(13-11-18)26(3)4/h6-13H,14-15H2,1-5H3 |
| InChIKey | NSLMLTRJUMIBFE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|