C28H23N5O3S — CID 3135251
N-(2-methyl-5-nitrophenyl)-2-[[5-(4-methylphenyl)-4-naphthalen-1-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 3135251) has the molecular formula C28H23N5O3S and a molecular weight of 509.59 g/mol. Its IUPAC name is N-(2-methyl-5-nitrophenyl)-2-[[5-(4-methylphenyl)-4-naphthalen-1-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-methyl-5-nitrophenyl)-2-[[5-(4-methylphenyl)-4-naphthalen-1-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3135251 |
| Molecular Formula | C28H23N5O3S |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | N-(2-methyl-5-nitrophenyl)-2-[[5-(4-methylphenyl)-4-naphthalen-1-yl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cc1ccc(-c2nnc(SCC(=O)Nc3cc([N+](=O)[O-])ccc3C)n2-c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C28H23N5O3S/c1-18-10-13-21(14-11-18)27-30-31-28(32(27)25-9-5-7-20-6-3-4-8-23(20)25)37-17-26(34)29-24-16-22(33(35)36)15-12-19(24)2/h3-16H,17H2,1-2H3,(H,29,34) |
| InChIKey | UMCIKRFQTLLGCR-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|