C26H25N5O6S — CID 3137226
N-(2-methyl-5-nitrophenyl)-2-[[4-phenyl-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 3137226) has the molecular formula C26H25N5O6S and a molecular weight of 535.58 g/mol. Its IUPAC name is N-(2-methyl-5-nitrophenyl)-2-[[4-phenyl-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-methyl-5-nitrophenyl)-2-[[4-phenyl-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3137226 |
| Molecular Formula | C26H25N5O6S |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | N-(2-methyl-5-nitrophenyl)-2-[[4-phenyl-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | COc1cc(-c2nnc(SCC(=O)Nc3cc([N+](=O)[O-])ccc3C)n2-c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C26H25N5O6S/c1-16-10-11-19(31(33)34)14-20(16)27-23(32)15-38-26-29-28-25(30(26)18-8-6-5-7-9-18)17-12-21(35-2)24(37-4)22(13-17)36-3/h5-14H,15H2,1-4H3,(H,27,32) |
| InChIKey | KTAQDSCBLRCIJG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 130.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|