C27H26N6O6S2 — CID 23964509
N-(2-methoxy-5-nitrophenyl)-2-[[4-phenyl-5-(3-pyrrolidin-1-ylsulfonylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 23964509) has the molecular formula C27H26N6O6S2 and a molecular weight of 594.68 g/mol. Its IUPAC name is N-(2-methoxy-5-nitrophenyl)-2-[[4-phenyl-5-(3-pyrrolidin-1-ylsulfonylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-methoxy-5-nitrophenyl)-2-[[4-phenyl-5-(3-pyrrolidin-1-ylsulfonylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 23964509 |
| Molecular Formula | C27H26N6O6S2 |
| Molecular Weight | 594.68 g/mol |
| Exact Mass | 594.14 |
| IUPAC Name | N-(2-methoxy-5-nitrophenyl)-2-[[4-phenyl-5-(3-pyrrolidin-1-ylsulfonylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)CSc1nnc(-c2cccc(S(=O)(=O)N3CCCC3)c2)n1-c1ccccc1 |
| InChI | InChI=1S/C27H26N6O6S2/c1-39-24-13-12-21(33(35)36)17-23(24)28-25(34)18-40-27-30-29-26(32(27)20-9-3-2-4-10-20)19-8-7-11-22(16-19)41(37,38)31-14-5-6-15-31/h2-4,7-13,16-17H,5-6,14-15,18H2,1H3,(H,28,34) |
| InChIKey | ACCQWDQVODJALO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 149.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.68 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|