C27H28N6O6S2 — CID 3588647
2-[[5-[3-(diethylsulfamoyl)phenyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide (PubChem CID 3588647) has the molecular formula C27H28N6O6S2 and a molecular weight of 596.69 g/mol. Its IUPAC name is 2-[[5-[3-(diethylsulfamoyl)phenyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide.
| Compound Name | 2-[[5-[3-(diethylsulfamoyl)phenyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3588647 |
| Molecular Formula | C27H28N6O6S2 |
| Molecular Weight | 596.69 g/mol |
| Exact Mass | 596.15 |
| IUPAC Name | 2-[[5-[3-(diethylsulfamoyl)phenyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(-c2nnc(SCC(=O)Nc3ccc(OC)cc3[N+](=O)[O-])n2-c2ccccc2)c1 |
| InChI | InChI=1S/C27H28N6O6S2/c1-4-31(5-2)41(37,38)22-13-9-10-19(16-22)26-29-30-27(32(26)20-11-7-6-8-12-20)40-18-25(34)28-23-15-14-21(39-3)17-24(23)33(35)36/h6-17H,4-5,18H2,1-3H3,(H,28,34) |
| InChIKey | DWTWEUYJMYWIEP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 149.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.69 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|