C31H36N6O3S2 — CID 4287401
2-[[5-[3-(diethylsulfamoyl)phenyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 4287401) has the molecular formula C31H36N6O3S2 and a molecular weight of 604.80 g/mol. Its IUPAC name is 2-[[5-[3-(diethylsulfamoyl)phenyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[[5-[3-(diethylsulfamoyl)phenyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 4287401 |
| Molecular Formula | C31H36N6O3S2 |
| Molecular Weight | 604.80 g/mol |
| Exact Mass | 604.23 |
| IUPAC Name | 2-[[5-[3-(diethylsulfamoyl)phenyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(-c2nnc(SCC(=O)Nc3ccc(N4CCCCC4)cc3)n2-c2ccccc2)c1 |
| InChI | InChI=1S/C31H36N6O3S2/c1-3-36(4-2)42(39,40)28-15-11-12-24(22-28)30-33-34-31(37(30)27-13-7-5-8-14-27)41-23-29(38)32-25-16-18-26(19-17-25)35-20-9-6-10-21-35/h5,7-8,11-19,22H,3-4,6,9-10,20-21,23H2,1-2H3,(H,32,38) |
| InChIKey | PCZYOXCNOYGVIW-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.80 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|