C26H25ClN6O5S2 — CID 4528610
N-(4-chloro-2-nitrophenyl)-2-[[5-[3-(diethylsulfamoyl)phenyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 4528610) has the molecular formula C26H25ClN6O5S2 and a molecular weight of 601.11 g/mol. Its IUPAC name is N-(4-chloro-2-nitrophenyl)-2-[[5-[3-(diethylsulfamoyl)phenyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(4-chloro-2-nitrophenyl)-2-[[5-[3-(diethylsulfamoyl)phenyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4528610 |
| Molecular Formula | C26H25ClN6O5S2 |
| Molecular Weight | 601.11 g/mol |
| Exact Mass | 600.10 |
| IUPAC Name | N-(4-chloro-2-nitrophenyl)-2-[[5-[3-(diethylsulfamoyl)phenyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(-c2nnc(SCC(=O)Nc3ccc(Cl)cc3[N+](=O)[O-])n2-c2ccccc2)c1 |
| InChI | InChI=1S/C26H25ClN6O5S2/c1-3-31(4-2)40(37,38)21-12-8-9-18(15-21)25-29-30-26(32(25)20-10-6-5-7-11-20)39-17-24(34)28-22-14-13-19(27)16-23(22)33(35)36/h5-16H,3-4,17H2,1-2H3,(H,28,34) |
| InChIKey | XFRYCKWLXNZXAC-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 140.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.11 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|