C26H23Cl2N5O3S — CID 23767655
2-[[5-(2,4-dichlorophenyl)-4-(2,6-diethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-nitrophenyl)acetamide (PubChem CID 23767655) has the molecular formula C26H23Cl2N5O3S and a molecular weight of 556.48 g/mol. Its IUPAC name is 2-[[5-(2,4-dichlorophenyl)-4-(2,6-diethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-nitrophenyl)acetamide.
| Compound Name | 2-[[5-(2,4-dichlorophenyl)-4-(2,6-diethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 23767655 |
| Molecular Formula | C26H23Cl2N5O3S |
| Molecular Weight | 556.48 g/mol |
| Exact Mass | 555.09 |
| IUPAC Name | 2-[[5-(2,4-dichlorophenyl)-4-(2,6-diethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-nitrophenyl)acetamide |
| SMILES | CCc1cccc(CC)c1-n1c(SCC(=O)Nc2ccccc2[N+](=O)[O-])nnc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H23Cl2N5O3S/c1-3-16-8-7-9-17(4-2)24(16)32-25(19-13-12-18(27)14-20(19)28)30-31-26(32)37-15-23(34)29-21-10-5-6-11-22(21)33(35)36/h5-14H,3-4,15H2,1-2H3,(H,29,34) |
| InChIKey | XAVIAFSSWMQCIU-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.48 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|