C27H24Cl3N5O3S — CID 3988791
N-(2-chloro-4-nitrophenyl)-2-[[5-(2,4-dichlorophenyl)-4-(2,6-diethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 3988791) has the molecular formula C27H24Cl3N5O3S and a molecular weight of 604.95 g/mol. Its IUPAC name is N-(2-chloro-4-nitrophenyl)-2-[[5-(2,4-dichlorophenyl)-4-(2,6-diethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | N-(2-chloro-4-nitrophenyl)-2-[[5-(2,4-dichlorophenyl)-4-(2,6-diethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 3988791 |
| Molecular Formula | C27H24Cl3N5O3S |
| Molecular Weight | 604.95 g/mol |
| Exact Mass | 603.07 |
| IUPAC Name | N-(2-chloro-4-nitrophenyl)-2-[[5-(2,4-dichlorophenyl)-4-(2,6-diethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | CCc1cccc(CC)c1-n1c(SC(C)C(=O)Nc2ccc([N+](=O)[O-])cc2Cl)nnc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H24Cl3N5O3S/c1-4-16-7-6-8-17(5-2)24(16)34-25(20-11-9-18(28)13-21(20)29)32-33-27(34)39-15(3)26(36)31-23-12-10-19(35(37)38)14-22(23)30/h6-15H,4-5H2,1-3H3,(H,31,36) |
| InChIKey | LJBPWHBLCKORHP-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.95 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|