C23H16Br2ClFN2O4 — CID 3135428
[2,4-dibromo-6-[[[2-(4-chloro-3-methylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-fluorobenzoate (PubChem CID 3135428) has the molecular formula C23H16Br2ClFN2O4 and a molecular weight of 598.65 g/mol. Its IUPAC name is [2,4-dibromo-6-[[[2-(4-chloro-3-methylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-fluorobenzoate.
| Compound Name | [2,4-dibromo-6-[[[2-(4-chloro-3-methylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-fluorobenzoate |
|---|---|
| PubChem CID | 3135428 |
| Molecular Formula | C23H16Br2ClFN2O4 |
| Molecular Weight | 598.65 g/mol |
| Exact Mass | 595.91 |
| IUPAC Name | [2,4-dibromo-6-[[[2-(4-chloro-3-methylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-fluorobenzoate |
| SMILES | Cc1cc(OCC(=O)NN=Cc2cc(Br)cc(Br)c2OC(=O)c2cccc(F)c2)ccc1Cl |
| InChI | InChI=1S/C23H16Br2ClFN2O4/c1-13-7-18(5-6-20(13)26)32-12-21(30)29-28-11-15-8-16(24)10-19(25)22(15)33-23(31)14-3-2-4-17(27)9-14/h2-11H,12H2,1H3,(H,29,30) |
| InChIKey | MWWONGWBCKCRDH-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.65 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|